C25H34O6 — CID 131668048
CID 131668048 (PubChem CID 131668048) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol.
| Compound Name | CID 131668048 |
|---|---|
| PubChem CID | 131668048 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | — |
| SMILES | C=C1C[C@@H]2[C@H]([C@@H](O)C[C@@]3(C)[C@H]2C[C@@H](C)[C@@]32OCOC23COCO3)[C@@]2(C)CCC(=O)C=C12 |
| InChI | InChI=1S/C25H34O6/c1-14-7-17-19-8-15(2)25(24(30-13-31-25)11-28-12-29-24)23(19,4)10-20(27)21(17)22(3)6-5-16(26)9-18(14)22/h9,15,17,19-21,27H,1,5-8,10-13H2,2-4H3/t15-,17+,19+,20+,21-,22+,23+,24?,25-/m1/s1 |
| InChIKey | QGTKFCDKMOWQCJ-FUQKSPMYSA-N |
| XLogP | 3.34 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |