C31H40ClNO6 — CID 91309261
CID 91309261 (PubChem CID 91309261) has the molecular formula C31H40ClNO6 and a molecular weight of 558.12 g/mol.
| Compound Name | CID 91309261 |
|---|---|
| PubChem CID | 91309261 |
| Molecular Formula | C31H40ClNO6 |
| Molecular Weight | 558.12 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | — |
| SMILES | C[C@@H]1C[C@H]2[C@H]3[C@H]([C@@H](O)C[C@]2(C)[C@]12OCOC21COCO1)[C@@]1(C)C=CC(=O)C=C1C[C@H]3Cl.Cc1cccc(N)c1 |
| InChI | InChI=1S/C24H31ClO6.C7H9N/c1-13-6-16-19-17(25)8-14-7-15(26)4-5-21(14,2)20(19)18(27)9-22(16,3)24(13)23(30-12-31-24)10-28-11-29-23;1-6-3-2-4-7(8)5-6/h4-5,7,13,16-20,27H,6,8-12H2,1-3H3;2-5H,8H2,1H3/t13-,16+,17-,18+,19-,20+,21+,22+,23?,24-;/m1./s1 |
| InChIKey | XNAIXOFFTVEUJB-GZQUODMVSA-N |
| XLogP | 4.75 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.12 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|