C26H34O7 — CID 99565693
CID 99565693 (PubChem CID 99565693) has the molecular formula C26H34O7 and a molecular weight of 458.55 g/mol.
| Compound Name | CID 99565693 |
|---|---|
| PubChem CID | 99565693 |
| Molecular Formula | C26H34O7 |
| Molecular Weight | 458.55 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | — |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](O)C[C@@]3(C)[C@H]2C[C@@H](C)[C@@]32OCO[C@]23COCO3)[C@@]2(C)C/C(=C/O)C(=O)C=C12 |
| InChI | InChI=1S/C26H34O7/c1-14-5-17-19-6-15(2)26(25(32-13-33-26)11-30-12-31-25)24(19,4)9-21(29)22(17)23(3)8-16(10-27)20(28)7-18(14)23/h5,7,10,15,17,19,21-22,27,29H,6,8-9,11-13H2,1-4H3/b16-10-/t15-,17+,19+,21-,22-,23+,24+,25-,26-/m1/s1 |
| InChIKey | WKLPTHVGGWUGJV-YWAYHHJBSA-N |
| XLogP | 3.40 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.55 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|