C31H31NO9 — CID 131724424
2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(1S,2S,5S)-1-phenyl-8-azabicyclo[3.2.1]octan-2-ol (PubChem CID 131724424) has the molecular formula C31H31NO9 and a molecular weight of 561.59 g/mol. Its IUPAC name is 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(1S,2S,5S)-1-phenyl-8-azabicyclo[3.2.1]octan-2-ol.
| Compound Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(1S,2S,5S)-1-phenyl-8-azabicyclo[3.2.1]octan-2-ol |
|---|---|
| PubChem CID | 131724424 |
| Molecular Formula | C31H31NO9 |
| Molecular Weight | 561.59 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(1S,2S,5S)-1-phenyl-8-azabicyclo[3.2.1]octan-2-ol |
| SMILES | O=C(O)C(O)(C(=O)c1ccccc1)C(O)(C(=O)O)C(=O)c1ccccc1.O[C@H]1CC[C@@H]2CC[C@@]1(c1ccccc1)N2 |
| InChI | InChI=1S/C18H14O8.C13H17NO/c19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12;15-12-7-6-11-8-9-13(12,14-11)10-4-2-1-3-5-10/h1-10,25-26H,(H,21,22)(H,23,24);1-5,11-12,14-15H,6-9H2/t;11-,12+,13+/m.1/s1 |
| InChIKey | IDFMSEHDMLXUOV-BVTWBBQLSA-N |
| XLogP | 2.17 |
| TPSA | 181.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|