C6H9NaO7 — CID 131741433
sodium (Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate (PubChem CID 131741433) has the molecular formula C6H9NaO7 and a molecular weight of 216.12 g/mol. Its IUPAC name is sodium (Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate.
| Compound Name | sodium (Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate |
|---|---|
| PubChem CID | 131741433 |
| Molecular Formula | C6H9NaO7 |
| Molecular Weight | 216.12 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | sodium (Z,4R,5S)-2,3,4,5,6-pentahydroxyhex-2-enoate |
| SMILES | O=C([O-])/C(O)=C(/O)[C@H](O)[C@@H](O)CO.[Na+] |
| InChI | InChI=1S/C6H10O7.Na/c7-1-2(8)3(9)4(10)5(11)6(12)13;/h2-3,7-11H,1H2,(H,12,13);/q;+1/p-1/b5-4-;/t2-,3+;/m0./s1 |
| InChIKey | NEVQBUKANAHIGH-MZEQWOQGSA-M |
| XLogP | -6.22 |
| TPSA | 141.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.12 |
| LogP ≤ 5 | -6.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|