C15H21N3O2Si — CID 131748591
5-methyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyridine-6-carbonitrile (PubChem CID 131748591) has the molecular formula C15H21N3O2Si and a molecular weight of 303.44 g/mol. Its IUPAC name is 5-methyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyridine-6-carbonitrile.
| Compound Name | 5-methyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyridine-6-carbonitrile |
|---|---|
| PubChem CID | 131748591 |
| Molecular Formula | C15H21N3O2Si |
| Molecular Weight | 303.44 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 5-methyl-7-oxo-1-(2-trimethylsilylethoxymethyl)pyrazolo[1,5-a]pyridine-6-carbonitrile |
| SMILES | Cc1cc2ccn(COCC[Si](C)(C)C)n2c(=O)c1C#N |
| InChI | InChI=1S/C15H21N3O2Si/c1-12-9-13-5-6-17(11-20-7-8-21(2,3)4)18(13)15(19)14(12)10-16/h5-6,9H,7-8,11H2,1-4H3 |
| InChIKey | ZFPVSJLSJVPNSM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 59.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|