C18H18ClFN2O4S3 — CID 131968435
5-chloro-N-[(3E,5E)-5-[(4-fluorophenyl)sulfonylamino]-2-methylhepta-1,3,5-trien-4-yl]thiophene-2-sulfonamide (PubChem CID 131968435) has the molecular formula C18H18ClFN2O4S3 and a molecular weight of 477.00 g/mol. Its IUPAC name is 5-chloro-N-[(3E,5E)-5-[(4-fluorophenyl)sulfonylamino]-2-methylhepta-1,3,5-trien-4-yl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[(3E,5E)-5-[(4-fluorophenyl)sulfonylamino]-2-methylhepta-1,3,5-trien-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 131968435 |
| Molecular Formula | C18H18ClFN2O4S3 |
| Molecular Weight | 477.00 g/mol |
| Exact Mass | 476.01 |
| IUPAC Name | 5-chloro-N-[(3E,5E)-5-[(4-fluorophenyl)sulfonylamino]-2-methylhepta-1,3,5-trien-4-yl]thiophene-2-sulfonamide |
| SMILES | C=C(C)/C=C(NS(=O)(=O)c1ccc(Cl)s1)\C(=C/C)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H18ClFN2O4S3/c1-4-15(21-28(23,24)14-7-5-13(20)6-8-14)16(11-12(2)3)22-29(25,26)18-10-9-17(19)27-18/h4-11,21-22H,2H2,1,3H3/b15-4+,16-11+ |
| InChIKey | NLTMJGIAYQCTCT-URWGOJBTSA-N |
| XLogP | 4.16 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.00 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|