C22H27NO4S — CID 132513067
[(3aR,8aR)-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,8a-tetrahydrocyclohepta[c]pyrrol-6-yl] 2,2-dimethylpropanoate (PubChem CID 132513067) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is [(3aR,8aR)-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,8a-tetrahydrocyclohepta[c]pyrrol-6-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3aR,8aR)-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,8a-tetrahydrocyclohepta[c]pyrrol-6-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 132513067 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(3aR,8aR)-4-methylidene-2-(4-methylphenyl)sulfonyl-1,3,3a,8a-tetrahydrocyclohepta[c]pyrrol-6-yl] 2,2-dimethylpropanoate |
| SMILES | C=C1C=C(OC(=O)C(C)(C)C)C=C[C@H]2CN(S(=O)(=O)c3ccc(C)cc3)C[C@@H]12 |
| InChI | InChI=1S/C22H27NO4S/c1-15-6-10-19(11-7-15)28(25,26)23-13-17-8-9-18(12-16(2)20(17)14-23)27-21(24)22(3,4)5/h6-12,17,20H,2,13-14H2,1,3-5H3/t17-,20-/m0/s1 |
| InChIKey | XPIMFEPJEHBDQV-PXNSSMCTSA-N |
| XLogP | 3.83 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |