C46H28N6O4S — CID 132521798
N-(4-nitrophenyl)-4-[2-[4-[2-[4-(N-(4-nitrophenyl)anilino)phenyl]ethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]-N-phenylaniline (PubChem CID 132521798) has the molecular formula C46H28N6O4S and a molecular weight of 760.83 g/mol. Its IUPAC name is N-(4-nitrophenyl)-4-[2-[4-[2-[4-(N-(4-nitrophenyl)anilino)phenyl]ethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]-N-phenylaniline.
| Compound Name | N-(4-nitrophenyl)-4-[2-[4-[2-[4-(N-(4-nitrophenyl)anilino)phenyl]ethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]-N-phenylaniline |
|---|---|
| PubChem CID | 132521798 |
| Molecular Formula | C46H28N6O4S |
| Molecular Weight | 760.83 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | N-(4-nitrophenyl)-4-[2-[4-[2-[4-(N-(4-nitrophenyl)anilino)phenyl]ethynyl]-2,1,3-benzothiadiazol-7-yl]ethynyl]-N-phenylaniline |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccccc2)c2ccc(C#Cc3ccc(C#Cc4ccc(N(c5ccccc5)c5ccc([N+](=O)[O-])cc5)cc4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C46H28N6O4S/c53-51(54)43-29-25-41(26-30-43)49(37-7-3-1-4-8-37)39-21-13-33(14-22-39)11-17-35-19-20-36(46-45(35)47-57-48-46)18-12-34-15-23-40(24-16-34)50(38-9-5-2-6-10-38)42-27-31-44(32-28-42)52(55)56/h1-10,13-16,19-32H |
| InChIKey | PTUXCUGYIHRPCR-UHFFFAOYSA-N |
| XLogP | 11.25 |
| TPSA | 118.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.83 |
| LogP ≤ 5 | 11.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|