C49H20F36P2+2 — CID 132541300
tris[3,5-bis(trifluoromethyl)phenyl]-[tris[3,5-bis(trifluoromethyl)phenyl]phosphaniumylmethyl]phosphanium (PubChem CID 132541300) has the molecular formula C49H20F36P2+2 and a molecular weight of 1354.57 g/mol. Its IUPAC name is tris[3,5-bis(trifluoromethyl)phenyl]-[tris[3,5-bis(trifluoromethyl)phenyl]phosphaniumylmethyl]phosphanium.
| Compound Name | tris[3,5-bis(trifluoromethyl)phenyl]-[tris[3,5-bis(trifluoromethyl)phenyl]phosphaniumylmethyl]phosphanium |
|---|---|
| PubChem CID | 132541300 |
| Molecular Formula | C49H20F36P2+2 |
| Molecular Weight | 1354.57 g/mol |
| Exact Mass | 1354.05 |
| IUPAC Name | tris[3,5-bis(trifluoromethyl)phenyl]-[tris[3,5-bis(trifluoromethyl)phenyl]phosphaniumylmethyl]phosphanium |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)cc([P+](C[P+](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)(c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C49H20F36P2/c50-38(51,52)20-1-21(39(53,54)55)8-32(7-20)86(33-9-22(40(56,57)58)2-23(10-33)41(59,60)61,34-11-24(42(62,63)64)3-25(12-34)43(65,66)67)19-87(35-13-26(44(68,69)70)4-27(14-35)45(71,72)73,36-15-28(46(74,75)76)5-29(16-36)47(77,78)79)37-17-30(48(80,81)82)6-31(18-37)49(83,84)85/h1-18H,19H2/q+2 |
| InChIKey | NRIARERLSQEEMM-UHFFFAOYSA-N |
| XLogP | 19.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 87 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1354.57 |
| LogP ≤ 5 | 19.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|