C17H10OS4 — CID 132555372
2,3-bis(1,3-benzodithiol-2-ylidene)propanal (PubChem CID 132555372) has the molecular formula C17H10OS4 and a molecular weight of 358.53 g/mol. Its IUPAC name is 2,3-bis(1,3-benzodithiol-2-ylidene)propanal.
| Compound Name | 2,3-bis(1,3-benzodithiol-2-ylidene)propanal |
|---|---|
| PubChem CID | 132555372 |
| Molecular Formula | C17H10OS4 |
| Molecular Weight | 358.53 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | 2,3-bis(1,3-benzodithiol-2-ylidene)propanal |
| SMILES | O=CC(C=C1Sc2ccccc2S1)=C1Sc2ccccc2S1 |
| InChI | InChI=1S/C17H10OS4/c18-10-11(17-21-14-7-3-4-8-15(14)22-17)9-16-19-12-5-1-2-6-13(12)20-16/h1-10H |
| InChIKey | VGXMCOMSIXLULP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.53 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|