C11H10O3S3 — CID 58906037
1-(1,3-benzodithiol-2-ylidene)-1-methylsulfonylpropan-2-one (PubChem CID 58906037) has the molecular formula C11H10O3S3 and a molecular weight of 286.40 g/mol. Its IUPAC name is 1-(1,3-benzodithiol-2-ylidene)-1-methylsulfonylpropan-2-one.
| Compound Name | 1-(1,3-benzodithiol-2-ylidene)-1-methylsulfonylpropan-2-one |
|---|---|
| PubChem CID | 58906037 |
| Molecular Formula | C11H10O3S3 |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | 1-(1,3-benzodithiol-2-ylidene)-1-methylsulfonylpropan-2-one |
| SMILES | CC(=O)C(=C1Sc2ccccc2S1)S(C)(=O)=O |
| InChI | InChI=1S/C11H10O3S3/c1-7(12)10(17(2,13)14)11-15-8-5-3-4-6-9(8)16-11/h3-6H,1-2H3 |
| InChIKey | AYSPRXIVAVMORZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|