C10H11Br5 — CID 132569062
(5S,7R)-1,2,2,6,6-pentabromoadamantane (PubChem CID 132569062) has the molecular formula C10H11Br5 and a molecular weight of 530.72 g/mol. Its IUPAC name is (5S,7R)-1,2,2,6,6-pentabromoadamantane.
| Compound Name | (5S,7R)-1,2,2,6,6-pentabromoadamantane |
|---|---|
| PubChem CID | 132569062 |
| Molecular Formula | C10H11Br5 |
| Molecular Weight | 530.72 g/mol |
| Exact Mass | 525.68 |
| IUPAC Name | (5S,7R)-1,2,2,6,6-pentabromoadamantane |
| SMILES | BrC1(Br)[C@@H]2CC3C[C@H]1CC(Br)(C2)C3(Br)Br |
| InChI | InChI=1S/C10H11Br5/c11-8-3-6-1-5(10(8,14)15)2-7(4-8)9(6,12)13/h5-7H,1-4H2/t5?,6-,7+,8? |
| InChIKey | VNOMHYTWEUGEKF-XSHWGTKXSA-N |
| XLogP | 5.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.72 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|