C32H37NO6Si — CID 132580780
ethyl (3aR,6R,6aS)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate (PubChem CID 132580780) has the molecular formula C32H37NO6Si and a molecular weight of 559.74 g/mol. Its IUPAC name is ethyl (3aR,6R,6aS)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate.
| Compound Name | ethyl (3aR,6R,6aS)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 132580780 |
| Molecular Formula | C32H37NO6Si |
| Molecular Weight | 559.74 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | ethyl (3aR,6R,6aS)-2-benzyl-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-oxo-3,3a,6,6a-tetrahydrofuro[3,4-d][1,2]oxazole-3-carboxylate |
| SMILES | CCOC(=O)C1[C@H]2C(=O)O[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)[C@H]2ON1Cc1ccccc1 |
| InChI | InChI=1S/C32H37NO6Si/c1-5-36-31(35)28-27-29(39-33(28)21-23-15-9-6-10-16-23)26(38-30(27)34)22-37-40(32(2,3)4,24-17-11-7-12-18-24)25-19-13-8-14-20-25/h6-20,26-29H,5,21-22H2,1-4H3/t26-,27-,28?,29-/m1/s1 |
| InChIKey | RFAQHYRQQHNEBC-HWMCGDIZSA-N |
| XLogP | 3.85 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.74 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|