C16H12BrN3O2S — CID 132607916
2-(2-bromophenyl)-1'-methyl-3-sulfanylidenespiro[1,2,4-oxadiazolidine-5,3'-indole]-2'-one (PubChem CID 132607916) has the molecular formula C16H12BrN3O2S and a molecular weight of 390.26 g/mol. Its IUPAC name is 2-(2-bromophenyl)-1'-methyl-3-sulfanylidenespiro[1,2,4-oxadiazolidine-5,3'-indole]-2'-one.
| Compound Name | 2-(2-bromophenyl)-1'-methyl-3-sulfanylidenespiro[1,2,4-oxadiazolidine-5,3'-indole]-2'-one |
|---|---|
| PubChem CID | 132607916 |
| Molecular Formula | C16H12BrN3O2S |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 388.98 |
| IUPAC Name | 2-(2-bromophenyl)-1'-methyl-3-sulfanylidenespiro[1,2,4-oxadiazolidine-5,3'-indole]-2'-one |
| SMILES | CN1C(=O)C2(NC(=S)N(c3ccccc3Br)O2)c2ccccc21 |
| InChI | InChI=1S/C16H12BrN3O2S/c1-19-12-8-4-2-6-10(12)16(14(19)21)18-15(23)20(22-16)13-9-5-3-7-11(13)17/h2-9H,1H3,(H,18,23) |
| InChIKey | FLSGYQDCANPYOI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|