C10H9NO3PS2+ — CID 133064495
methoxy([1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium-1-yl)phosphinic acid (PubChem CID 133064495) has the molecular formula C10H9NO3PS2+ and a molecular weight of 286.29 g/mol. Its IUPAC name is methoxy([1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium-1-yl)phosphinic acid.
| Compound Name | methoxy([1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium-1-yl)phosphinic acid |
|---|---|
| PubChem CID | 133064495 |
| Molecular Formula | C10H9NO3PS2+ |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | methoxy([1,3]thiazolo[2,3-b][1,3]benzothiazol-9-ium-1-yl)phosphinic acid |
| SMILES | COP(=O)(O)c1csc2sc3ccccc3[n+]12 |
| InChI | InChI=1S/C10H8NO3PS2/c1-14-15(12,13)9-6-16-10-11(9)7-4-2-3-5-8(7)17-10/h2-6H,1H3/p+1 |
| InChIKey | GLTLMWGTYRDIFG-UHFFFAOYSA-O |
| XLogP | 2.16 |
| TPSA | 50.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|