C15H21N3O2 — CID 133498293
4-(3,5-dimethylpiperidin-1-yl)-5-nitro-2,3-dihydro-1H-indole (PubChem CID 133498293) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 4-(3,5-dimethylpiperidin-1-yl)-5-nitro-2,3-dihydro-1H-indole.
| Compound Name | 4-(3,5-dimethylpiperidin-1-yl)-5-nitro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 133498293 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 4-(3,5-dimethylpiperidin-1-yl)-5-nitro-2,3-dihydro-1H-indole |
| SMILES | CC1CC(C)CN(c2c([N+](=O)[O-])ccc3c2CCN3)C1 |
| InChI | InChI=1S/C15H21N3O2/c1-10-7-11(2)9-17(8-10)15-12-5-6-16-13(12)3-4-14(15)18(19)20/h3-4,10-11,16H,5-9H2,1-2H3 |
| InChIKey | MMGBCIDJZFFNGX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|