C9H10N2O5S2 — CID 13392679
2-N,2-N-dimethyl-1-N-(oxomethylidene)benzene-1,2-disulfonamide (PubChem CID 13392679) has the molecular formula C9H10N2O5S2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-1-N-(oxomethylidene)benzene-1,2-disulfonamide.
| Compound Name | 2-N,2-N-dimethyl-1-N-(oxomethylidene)benzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 13392679 |
| Molecular Formula | C9H10N2O5S2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.00 |
| IUPAC Name | 2-N,2-N-dimethyl-1-N-(oxomethylidene)benzene-1,2-disulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccccc1S(=O)(=O)N=C=O |
| InChI | InChI=1S/C9H10N2O5S2/c1-11(2)18(15,16)9-6-4-3-5-8(9)17(13,14)10-7-12/h3-6H,1-2H3 |
| InChIKey | BDUGEGRLSBCJTH-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 100.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|