C18H9Cl2NO2S2 — CID 134065400
3-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]chromen-2-one (PubChem CID 134065400) has the molecular formula C18H9Cl2NO2S2 and a molecular weight of 406.32 g/mol. Its IUPAC name is 3-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]chromen-2-one.
| Compound Name | 3-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]chromen-2-one |
|---|---|
| PubChem CID | 134065400 |
| Molecular Formula | C18H9Cl2NO2S2 |
| Molecular Weight | 406.32 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | 3-[[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]sulfanyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1Sc1nc(-c2ccc(Cl)cc2Cl)cs1 |
| InChI | InChI=1S/C18H9Cl2NO2S2/c19-11-5-6-12(13(20)8-11)14-9-24-18(21-14)25-16-7-10-3-1-2-4-15(10)23-17(16)22/h1-9H |
| InChIKey | VCBVQECBSFCRKG-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.32 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|