C6H8O4S2 — CID 13407200
6a-methyl-4,4-dioxo-5,6-dihydro-3aH-thieno[3,2-d][1,3]oxathiol-2-one (PubChem CID 13407200) has the molecular formula C6H8O4S2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 6a-methyl-4,4-dioxo-5,6-dihydro-3aH-thieno[3,2-d][1,3]oxathiol-2-one.
| Compound Name | 6a-methyl-4,4-dioxo-5,6-dihydro-3aH-thieno[3,2-d][1,3]oxathiol-2-one |
|---|---|
| PubChem CID | 13407200 |
| Molecular Formula | C6H8O4S2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 6a-methyl-4,4-dioxo-5,6-dihydro-3aH-thieno[3,2-d][1,3]oxathiol-2-one |
| SMILES | CC12CCS(=O)(=O)C1OC(=O)S2 |
| InChI | InChI=1S/C6H8O4S2/c1-6-2-3-12(8,9)4(6)10-5(7)11-6/h4H,2-3H2,1H3 |
| InChIKey | BEKJJYKTRCSXOW-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|