C10H14O9S2 — CID 170068385
4-(4-methyl-2,2-dioxooxathiolan-4-yl)-8,8-dioxo-1,3,9-trioxa-8λ6-thiaspiro[4.5]decan-2-one (PubChem CID 170068385) has the molecular formula C10H14O9S2 and a molecular weight of 342.35 g/mol. Its IUPAC name is 4-(4-methyl-2,2-dioxooxathiolan-4-yl)-8,8-dioxo-1,3,9-trioxa-8λ6-thiaspiro[4.5]decan-2-one.
| Compound Name | 4-(4-methyl-2,2-dioxooxathiolan-4-yl)-8,8-dioxo-1,3,9-trioxa-8λ6-thiaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 170068385 |
| Molecular Formula | C10H14O9S2 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 4-(4-methyl-2,2-dioxooxathiolan-4-yl)-8,8-dioxo-1,3,9-trioxa-8λ6-thiaspiro[4.5]decan-2-one |
| SMILES | CC1(C2OC(=O)OC23CCS(=O)(=O)OC3)COS(=O)(=O)C1 |
| InChI | InChI=1S/C10H14O9S2/c1-9(4-16-21(14,15)6-9)7-10(19-8(11)18-7)2-3-20(12,13)17-5-10/h7H,2-6H2,1H3 |
| InChIKey | HXUCMRFAHNKJJM-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|