C42H70N8O8 — CID 134139700
3,6-bis[3-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-2-hydroxypropoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one (PubChem CID 134139700) has the molecular formula C42H70N8O8 and a molecular weight of 815.07 g/mol. Its IUPAC name is 3,6-bis[3-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-2-hydroxypropoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one.
| Compound Name | 3,6-bis[3-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-2-hydroxypropoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
|---|---|
| PubChem CID | 134139700 |
| Molecular Formula | C42H70N8O8 |
| Molecular Weight | 815.07 g/mol |
| Exact Mass | 814.53 |
| IUPAC Name | 3,6-bis[3-[2-[2-(2-aminoethylamino)ethylamino]ethylamino]-2-hydroxypropoxy]-1-hydroxy-7-methoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
| SMILES | COc1c(OCC(O)CNCCNCCNCCN)cc2oc3cc(OCC(O)CNCCNCCNCCN)c(CC=C(C)C)c(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C42H70N8O8/c1-28(2)6-8-32-34(56-26-30(51)24-49-20-18-47-16-14-45-12-10-43)22-36-39(40(32)53)41(54)38-33(9-7-29(3)4)42(55-5)37(23-35(38)58-36)57-27-31(52)25-50-21-19-48-17-15-46-13-11-44/h6-7,22-23,30-31,45-53H,8-21,24-27,43-44H2,1-5H3 |
| InChIKey | FGMACMVMWWOMOL-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 242.81 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.07 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|