C8Cl2F6 — CID 13416586
1-chloro-4-(1-chloro-2,2-difluoroethenyl)-2,3,5,6-tetrafluorobenzene (PubChem CID 13416586) has the molecular formula C8Cl2F6 and a molecular weight of 280.98 g/mol. Its IUPAC name is 1-chloro-4-(1-chloro-2,2-difluoroethenyl)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-chloro-4-(1-chloro-2,2-difluoroethenyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 13416586 |
| Molecular Formula | C8Cl2F6 |
| Molecular Weight | 280.98 g/mol |
| Exact Mass | 279.93 |
| IUPAC Name | 1-chloro-4-(1-chloro-2,2-difluoroethenyl)-2,3,5,6-tetrafluorobenzene |
| SMILES | FC(F)=C(Cl)c1c(F)c(F)c(Cl)c(F)c1F |
| InChI | InChI=1S/C8Cl2F6/c9-2(8(15)16)1-4(11)6(13)3(10)7(14)5(1)12 |
| InChIKey | NYHAGWKXWXYHID-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.98 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|