C15H13BrClF3O — CID 134217946
1-[2-bromo-4-[(1E,4E)-6-chloro-3-(trifluoromethyl)hexa-1,4-dienyl]phenyl]ethanone (PubChem CID 134217946) has the molecular formula C15H13BrClF3O and a molecular weight of 381.62 g/mol. Its IUPAC name is 1-[2-bromo-4-[(1E,4E)-6-chloro-3-(trifluoromethyl)hexa-1,4-dienyl]phenyl]ethanone.
| Compound Name | 1-[2-bromo-4-[(1E,4E)-6-chloro-3-(trifluoromethyl)hexa-1,4-dienyl]phenyl]ethanone |
|---|---|
| PubChem CID | 134217946 |
| Molecular Formula | C15H13BrClF3O |
| Molecular Weight | 381.62 g/mol |
| Exact Mass | 379.98 |
| IUPAC Name | 1-[2-bromo-4-[(1E,4E)-6-chloro-3-(trifluoromethyl)hexa-1,4-dienyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(/C=C/C(/C=C/CCl)C(F)(F)F)cc1Br |
| InChI | InChI=1S/C15H13BrClF3O/c1-10(21)13-7-5-11(9-14(13)16)4-6-12(3-2-8-17)15(18,19)20/h2-7,9,12H,8H2,1H3/b3-2+,6-4+ |
| InChIKey | LGOWCPOUNQDKHU-WJPDYIDTSA-N |
| XLogP | 5.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.62 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|