C18H19N3O6S3 — CID 134247358
N-[4-hydroxy-5-methoxy-2-methylsulfanyl-3-[3-oxo-3-(4-oxoimidazolidin-1-yl)prop-1-enyl]phenyl]thiophene-2-sulfonamide (PubChem CID 134247358) has the molecular formula C18H19N3O6S3 and a molecular weight of 469.57 g/mol. Its IUPAC name is N-[4-hydroxy-5-methoxy-2-methylsulfanyl-3-[3-oxo-3-(4-oxoimidazolidin-1-yl)prop-1-enyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-hydroxy-5-methoxy-2-methylsulfanyl-3-[3-oxo-3-(4-oxoimidazolidin-1-yl)prop-1-enyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 134247358 |
| Molecular Formula | C18H19N3O6S3 |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | N-[4-hydroxy-5-methoxy-2-methylsulfanyl-3-[3-oxo-3-(4-oxoimidazolidin-1-yl)prop-1-enyl]phenyl]thiophene-2-sulfonamide |
| SMILES | COc1cc(NS(=O)(=O)c2cccs2)c(SC)c(C=CC(=O)N2CNC(=O)C2)c1O |
| InChI | InChI=1S/C18H19N3O6S3/c1-27-13-8-12(20-30(25,26)16-4-3-7-29-16)18(28-2)11(17(13)24)5-6-15(23)21-9-14(22)19-10-21/h3-8,20,24H,9-10H2,1-2H3,(H,19,22) |
| InChIKey | QAYLFDAVTZXIKX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|