C17H16N4O6S3 — CID 136639857
5-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylamino)phenyl]ethenyl]-1,3,4-oxadiazole-2-carboxamide (PubChem CID 136639857) has the molecular formula C17H16N4O6S3 and a molecular weight of 468.54 g/mol. Its IUPAC name is 5-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylamino)phenyl]ethenyl]-1,3,4-oxadiazole-2-carboxamide.
| Compound Name | 5-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylamino)phenyl]ethenyl]-1,3,4-oxadiazole-2-carboxamide |
|---|---|
| PubChem CID | 136639857 |
| Molecular Formula | C17H16N4O6S3 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 5-[(E)-2-[2-hydroxy-3-methoxy-6-methylsulfanyl-5-(thiophen-2-ylsulfonylamino)phenyl]ethenyl]-1,3,4-oxadiazole-2-carboxamide |
| SMILES | COc1cc(NS(=O)(=O)c2cccs2)c(SC)c(/C=C/c2nnc(C(N)=O)o2)c1O |
| InChI | InChI=1S/C17H16N4O6S3/c1-26-11-8-10(21-30(24,25)13-4-3-7-29-13)15(28-2)9(14(11)22)5-6-12-19-20-17(27-12)16(18)23/h3-8,21-22H,1-2H3,(H2,18,23)/b6-5+ |
| InChIKey | NYDUISIJPQJEGT-AATRIKPKSA-N |
| XLogP | 2.64 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|