C32H33ClN2O4S — CID 134265411
2-[[4-[2-[[4-(4-tert-butylphenyl)anilino]methyl]-5-chlorophenyl]benzoyl]amino]ethanesulfonic acid (PubChem CID 134265411) has the molecular formula C32H33ClN2O4S and a molecular weight of 577.15 g/mol. Its IUPAC name is 2-[[4-[2-[[4-(4-tert-butylphenyl)anilino]methyl]-5-chlorophenyl]benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[4-[2-[[4-(4-tert-butylphenyl)anilino]methyl]-5-chlorophenyl]benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 134265411 |
| Molecular Formula | C32H33ClN2O4S |
| Molecular Weight | 577.15 g/mol |
| Exact Mass | 576.18 |
| IUPAC Name | 2-[[4-[2-[[4-(4-tert-butylphenyl)anilino]methyl]-5-chlorophenyl]benzoyl]amino]ethanesulfonic acid |
| SMILES | CC(C)(C)c1ccc(-c2ccc(NCc3ccc(Cl)cc3-c3ccc(C(=O)NCCS(=O)(=O)O)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H33ClN2O4S/c1-32(2,3)27-13-8-22(9-14-27)23-11-16-29(17-12-23)35-21-26-10-15-28(33)20-30(26)24-4-6-25(7-5-24)31(36)34-18-19-40(37,38)39/h4-17,20,35H,18-19,21H2,1-3H3,(H,34,36)(H,37,38,39) |
| InChIKey | JVJSAOGBIUNGOG-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.15 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|