C42H36N2O17 — CID 134265581
acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-4-[(3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]-2-methoxyanilino]acetate (PubChem CID 134265581) has the molecular formula C42H36N2O17 and a molecular weight of 840.75 g/mol. Its IUPAC name is acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-4-[(3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]-2-methoxyanilino]acetate.
| Compound Name | acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-4-[(3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]-2-methoxyanilino]acetate |
|---|---|
| PubChem CID | 134265581 |
| Molecular Formula | C42H36N2O17 |
| Molecular Weight | 840.75 g/mol |
| Exact Mass | 840.20 |
| IUPAC Name | acetyloxymethyl 2-[N-[2-(acetyloxymethoxy)-2-oxoethyl]-4-[(3',6'-diacetyloxy-1-oxospiro[2-benzofuran-3,9'-xanthene]-5-carbonyl)amino]-2-methoxyanilino]acetate |
| SMILES | COc1cc(NC(=O)c2ccc3c(c2)C2(OC3=O)c3ccc(OC(C)=O)cc3Oc3cc(OC(C)=O)ccc32)ccc1N(CC(=O)OCOC(C)=O)CC(=O)OCOC(C)=O |
| InChI | InChI=1S/C42H36N2O17/c1-22(45)54-20-56-38(49)18-44(19-39(50)57-21-55-23(2)46)34-13-7-27(15-37(34)53-5)43-40(51)26-6-10-30-33(14-26)42(61-41(30)52)31-11-8-28(58-24(3)47)16-35(31)60-36-17-29(59-25(4)48)9-12-32(36)42/h6-17H,18-21H2,1-5H3,(H,43,51) |
| InChIKey | ICSGKRALDWXYHH-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 234.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|