C30H19F9O — CID 134371185
6-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-fluoro-2-methylphenyl]ethynyl]-1,3,8-trifluoronaphthalene (PubChem CID 134371185) has the molecular formula C30H19F9O and a molecular weight of 566.46 g/mol. Its IUPAC name is 6-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-fluoro-2-methylphenyl]ethynyl]-1,3,8-trifluoronaphthalene.
| Compound Name | 6-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-fluoro-2-methylphenyl]ethynyl]-1,3,8-trifluoronaphthalene |
|---|---|
| PubChem CID | 134371185 |
| Molecular Formula | C30H19F9O |
| Molecular Weight | 566.46 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | 6-butyl-2-[2-[4-[difluoro-(3,4,5-trifluorophenoxy)methyl]-5-fluoro-2-methylphenyl]ethynyl]-1,3,8-trifluoronaphthalene |
| SMILES | CCCCc1cc(F)c2c(F)c(C#Cc3cc(F)c(C(F)(F)Oc4cc(F)c(F)c(F)c4)cc3C)c(F)cc2c1 |
| InChI | InChI=1S/C30H19F9O/c1-3-4-5-16-9-18-12-22(31)20(28(36)27(18)24(33)10-16)7-6-17-11-23(32)21(8-15(17)2)30(38,39)40-19-13-25(34)29(37)26(35)14-19/h8-14H,3-5H2,1-2H3 |
| InChIKey | DIGOEGWIZDPSTC-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.46 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|