C32H45NO6 — CID 134378441
(Z)-4-butyl-1-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-4-methylnon-1-en-3-one (PubChem CID 134378441) has the molecular formula C32H45NO6 and a molecular weight of 539.71 g/mol. Its IUPAC name is (Z)-4-butyl-1-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-4-methylnon-1-en-3-one.
| Compound Name | (Z)-4-butyl-1-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-4-methylnon-1-en-3-one |
|---|---|
| PubChem CID | 134378441 |
| Molecular Formula | C32H45NO6 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.32 |
| IUPAC Name | (Z)-4-butyl-1-[4-hydroxy-5-methoxy-2-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]anilino]-4-methylnon-1-en-3-one |
| SMILES | CCCCCC(C)(CCCC)C(=O)/C=C\Nc1cc(OC)c(O)cc1/C=C\c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C32H45NO6/c1-8-10-12-17-32(3,16-11-9-2)30(35)15-18-33-25-22-27(36-4)26(34)21-24(25)14-13-23-19-28(37-5)31(39-7)29(20-23)38-6/h13-15,18-22,33-34H,8-12,16-17H2,1-7H3/b14-13-,18-15- |
| InChIKey | PYRUXGYDWIRSGQ-KFLNVWTGSA-N |
| XLogP | 7.87 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|