C16H15ClN4O4S — CID 134381175
(2-methylpyrazol-3-yl) 2-chloro-4-methylsulfonyl-3-(pyrazol-1-ylmethyl)benzoate (PubChem CID 134381175) has the molecular formula C16H15ClN4O4S and a molecular weight of 394.84 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl) 2-chloro-4-methylsulfonyl-3-(pyrazol-1-ylmethyl)benzoate.
| Compound Name | (2-methylpyrazol-3-yl) 2-chloro-4-methylsulfonyl-3-(pyrazol-1-ylmethyl)benzoate |
|---|---|
| PubChem CID | 134381175 |
| Molecular Formula | C16H15ClN4O4S |
| Molecular Weight | 394.84 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | (2-methylpyrazol-3-yl) 2-chloro-4-methylsulfonyl-3-(pyrazol-1-ylmethyl)benzoate |
| SMILES | Cn1nccc1OC(=O)c1ccc(S(C)(=O)=O)c(Cn2cccn2)c1Cl |
| InChI | InChI=1S/C16H15ClN4O4S/c1-20-14(6-8-18-20)25-16(22)11-4-5-13(26(2,23)24)12(15(11)17)10-21-9-3-7-19-21/h3-9H,10H2,1-2H3 |
| InChIKey | ZWDMBMXYIUVOCZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 96.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.84 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |