C18H23ClFN3O2 — CID 134422896
(E)-3-(3-chloro-5-fluorophenyl)-N-[[1-(2-formamidoethyl)piperidin-4-yl]methyl]prop-2-enamide (PubChem CID 134422896) has the molecular formula C18H23ClFN3O2 and a molecular weight of 367.85 g/mol. Its IUPAC name is (E)-3-(3-chloro-5-fluorophenyl)-N-[[1-(2-formamidoethyl)piperidin-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-chloro-5-fluorophenyl)-N-[[1-(2-formamidoethyl)piperidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 134422896 |
| Molecular Formula | C18H23ClFN3O2 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | (E)-3-(3-chloro-5-fluorophenyl)-N-[[1-(2-formamidoethyl)piperidin-4-yl]methyl]prop-2-enamide |
| SMILES | O=CNCCN1CCC(CNC(=O)/C=C/c2cc(F)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C18H23ClFN3O2/c19-16-9-15(10-17(20)11-16)1-2-18(25)22-12-14-3-6-23(7-4-14)8-5-21-13-24/h1-2,9-11,13-14H,3-8,12H2,(H,21,24)(H,22,25)/b2-1+ |
| InChIKey | IKLYJHQXLSNWID-OWOJBTEDSA-N |
| XLogP | 2.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|