C17H34N2 — CID 134504879
(3Z)-N-tert-butyl-3-ethylidene-4-(3-methylbutan-2-ylimino)hexan-1-amine (PubChem CID 134504879) has the molecular formula C17H34N2 and a molecular weight of 266.47 g/mol. Its IUPAC name is (3Z)-N-tert-butyl-3-ethylidene-4-(3-methylbutan-2-ylimino)hexan-1-amine.
| Compound Name | (3Z)-N-tert-butyl-3-ethylidene-4-(3-methylbutan-2-ylimino)hexan-1-amine |
|---|---|
| PubChem CID | 134504879 |
| Molecular Formula | C17H34N2 |
| Molecular Weight | 266.47 g/mol |
| Exact Mass | 266.27 |
| IUPAC Name | (3Z)-N-tert-butyl-3-ethylidene-4-(3-methylbutan-2-ylimino)hexan-1-amine |
| SMILES | C/C=C(CCNC(C)(C)C)\C(CC)=N\C(C)C(C)C |
| InChI | InChI=1S/C17H34N2/c1-9-15(11-12-18-17(6,7)8)16(10-2)19-14(5)13(3)4/h9,13-14,18H,10-12H2,1-8H3/b15-9-,19-16+ |
| InChIKey | ROMXOZZPMJRKCE-UQLDRGGGSA-N |
| XLogP | 4.61 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.47 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|