C22H23F7N2O2 — CID 134510918
(3S)-N-[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-methyl-5-oxopyrrolidine-3-carboxamide (PubChem CID 134510918) has the molecular formula C22H23F7N2O2 and a molecular weight of 480.42 g/mol. Its IUPAC name is (3S)-N-[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-methyl-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 134510918 |
| Molecular Formula | C22H23F7N2O2 |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | (3S)-N-[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-1-methyl-5-oxopyrrolidine-3-carboxamide |
| SMILES | CN1C[C@@H](C(=O)N[C@@H]2CC[C@H]3c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1=O |
| InChI | InChI=1S/C22H23F7N2O2/c1-31-10-12(9-18(31)32)19(33)30-17-7-6-15-14-5-3-13(8-11(14)2-4-16(15)17)20(23,21(24,25)26)22(27,28)29/h3,5,8,12,15-17H,2,4,6-7,9-10H2,1H3,(H,30,33)/t12-,15-,16+,17+/m0/s1 |
| InChIKey | DIEIHYABHCUPHO-KKBVYLPWSA-N |
| XLogP | 4.38 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |