C21H22F7NO2 — CID 155031791
(3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(1-hydroxycyclopropyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide (PubChem CID 155031791) has the molecular formula C21H22F7NO2 and a molecular weight of 453.40 g/mol. Its IUPAC name is (3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(1-hydroxycyclopropyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | (3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(1-hydroxycyclopropyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 155031791 |
| Molecular Formula | C21H22F7NO2 |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | (3R)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-[(1-hydroxycyclopropyl)methyl]-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
| SMILES | O=C(NCC1(O)CC1)[C@@H]1CCC2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC21 |
| InChI | InChI=1S/C21H22F7NO2/c22-19(20(23,24)25,21(26,27)28)12-2-4-13-11(9-12)1-3-15-14(13)5-6-16(15)17(30)29-10-18(31)7-8-18/h2,4,9,14-16,31H,1,3,5-8,10H2,(H,29,30)/t14?,15?,16-/m1/s1 |
| InChIKey | CBYGXQFHZXHSKP-UYSNPLJNSA-N |
| XLogP | 4.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |