C16H15F7 — CID 134510844
7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene (PubChem CID 134510844) has the molecular formula C16H15F7 and a molecular weight of 340.28 g/mol. Its IUPAC name is 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 134510844 |
| Molecular Formula | C16H15F7 |
| Molecular Weight | 340.28 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene |
| SMILES | FC(F)(F)C(F)(c1ccc2c(c1)CCC1CCCC21)C(F)(F)F |
| InChI | InChI=1S/C16H15F7/c17-14(15(18,19)20,16(21,22)23)11-6-7-13-10(8-11)5-4-9-2-1-3-12(9)13/h6-9,12H,1-5H2 |
| InChIKey | DJPVECUMNBLQNM-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.28 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |