C16H13F7N2 — CID 166668852
(3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonitrile (PubChem CID 166668852) has the molecular formula C16H13F7N2 and a molecular weight of 366.28 g/mol. Its IUPAC name is (3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonitrile.
| Compound Name | (3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonitrile |
|---|---|
| PubChem CID | 166668852 |
| Molecular Formula | C16H13F7N2 |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonitrile |
| SMILES | N#CN1CCC2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]21 |
| InChI | InChI=1S/C16H13F7N2/c17-14(15(18,19)20,16(21,22)23)10-2-3-11-9(7-10)1-4-13-12(11)5-6-25(13)8-24/h2-3,7,12-13H,1,4-6H2/t12?,13-/m1/s1 |
| InChIKey | QMBHFVPPOXBOJS-ZGTCLIOFSA-N |
| XLogP | 4.56 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|