C21H23F7N2O2S — CID 166668778
[(9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(3-methyl-1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 166668778) has the molecular formula C21H23F7N2O2S and a molecular weight of 500.48 g/mol. Its IUPAC name is [(9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(3-methyl-1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | [(9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(3-methyl-1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 166668778 |
| Molecular Formula | C21H23F7N2O2S |
| Molecular Weight | 500.48 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | [(9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(3-methyl-1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC1CS(=O)CCN1C(=O)N1CC[C@H]2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC21 |
| InChI | InChI=1S/C21H23F7N2O2S/c1-12-11-33(32)9-8-29(12)18(31)30-7-6-16-15-4-3-14(10-13(15)2-5-17(16)30)19(22,20(23,24)25)21(26,27)28/h3-4,10,12,16-17H,2,5-9,11H2,1H3/t12?,16-,17?,33?/m0/s1 |
| InChIKey | LBVDZWOXIMPZNQ-GPQOVYPPSA-N |
| XLogP | 4.65 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |