C21H24F7N3O2S — CID 166668808
7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-methyl-1-nitrosothiolan-3-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carboxamide (PubChem CID 166668808) has the molecular formula C21H24F7N3O2S and a molecular weight of 515.50 g/mol. Its IUPAC name is 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-methyl-1-nitrosothiolan-3-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carboxamide.
| Compound Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-methyl-1-nitrosothiolan-3-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carboxamide |
|---|---|
| PubChem CID | 166668808 |
| Molecular Formula | C21H24F7N3O2S |
| Molecular Weight | 515.50 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | 7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-N-(1-methyl-1-nitrosothiolan-3-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carboxamide |
| SMILES | CS1(N=O)CCC(NC(=O)N2CCC3c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CCC32)C1 |
| InChI | InChI=1S/C21H24F7N3O2S/c1-34(30-33)9-7-14(11-34)29-18(32)31-8-6-16-15-4-3-13(10-12(15)2-5-17(16)31)19(22,20(23,24)25)21(26,27)28/h3-4,10,14,16-17H,2,5-9,11H2,1H3,(H,29,32) |
| InChIKey | RHDKTTDZLMGQSM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.50 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |