C18H15F10NO — CID 145184073
1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 145184073) has the molecular formula C18H15F10NO and a molecular weight of 451.30 g/mol. Its IUPAC name is 1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 145184073 |
| Molecular Formula | C18H15F10NO |
| Molecular Weight | 451.30 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CC[C@H]2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]21 |
| InChI | InChI=1S/C18H15F10NO/c19-15(20,21)8-14(30)29-6-5-12-11-3-2-10(7-9(11)1-4-13(12)29)16(22,17(23,24)25)18(26,27)28/h2-3,7,12-13H,1,4-6,8H2/t12-,13+/m0/s1 |
| InChIKey | CYBVUFKPTSKKFS-QWHCGFSZSA-N |
| XLogP | 5.56 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.30 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |