C23H26F7NO — CID 155031811
[7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-(4-methylpiperidin-1-yl)methanone (PubChem CID 155031811) has the molecular formula C23H26F7NO and a molecular weight of 465.45 g/mol. Its IUPAC name is [7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-(4-methylpiperidin-1-yl)methanone.
| Compound Name | [7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-(4-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 155031811 |
| Molecular Formula | C23H26F7NO |
| Molecular Weight | 465.45 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]-(4-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)C2CCC3c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CCC23)CC1 |
| InChI | InChI=1S/C23H26F7NO/c1-13-8-10-31(11-9-13)20(32)19-7-6-17-16-5-3-15(12-14(16)2-4-18(17)19)21(24,22(25,26)27)23(28,29)30/h3,5,12-13,17-19H,2,4,6-11H2,1H3 |
| InChIKey | QSXFHBRWLVPLSE-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.45 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |