C16H13ClF7NO — CID 147854342
(3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl chloride (PubChem CID 147854342) has the molecular formula C16H13ClF7NO and a molecular weight of 403.73 g/mol. Its IUPAC name is (3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl chloride.
| Compound Name | (3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl chloride |
|---|---|
| PubChem CID | 147854342 |
| Molecular Formula | C16H13ClF7NO |
| Molecular Weight | 403.73 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | (3aR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl chloride |
| SMILES | O=C(Cl)N1CCC2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]21 |
| InChI | InChI=1S/C16H13ClF7NO/c17-13(26)25-6-5-11-10-3-2-9(7-8(10)1-4-12(11)25)14(18,15(19,20)21)16(22,23)24/h2-3,7,11-12H,1,4-6H2/t11?,12-/m1/s1 |
| InChIKey | NNBZFROZOOHBKQ-PIJUOVFKSA-N |
| XLogP | 5.44 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|