C24H28F7NO2 — CID 145184296
[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclooctyl)methanone (PubChem CID 145184296) has the molecular formula C24H28F7NO2 and a molecular weight of 495.48 g/mol. Its IUPAC name is [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclooctyl)methanone.
| Compound Name | [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclooctyl)methanone |
|---|---|
| PubChem CID | 145184296 |
| Molecular Formula | C24H28F7NO2 |
| Molecular Weight | 495.48 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclooctyl)methanone |
| SMILES | O=C(N1CC[C@H]2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]21)C1(O)CCCCCCC1 |
| InChI | InChI=1S/C24H28F7NO2/c25-22(23(26,27)28,24(29,30)31)16-7-8-17-15(14-16)6-9-19-18(17)10-13-32(19)20(33)21(34)11-4-2-1-3-5-12-21/h7-8,14,18-19,34H,1-6,9-13H2/t18-,19+/m0/s1 |
| InChIKey | BWFLTMKIXZJGCT-RBUKOAKNSA-N |
| XLogP | 6.08 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.48 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |