C24H26F7NO3 — CID 138592540
cis-(3S,4R)-4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-3-methylcyclohexane-1-carboxylic acid (PubChem CID 138592540) has the molecular formula C24H26F7NO3 and a molecular weight of 509.46 g/mol. Its IUPAC name is cis-(3S,4R)-4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-3-methylcyclohexane-1-carboxylic acid.
| Compound Name | cis-(3S,4R)-4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-3-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 138592540 |
| Molecular Formula | C24H26F7NO3 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | cis-(3S,4R)-4-[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indole-3-carbonyl]-3-methylcyclohexane-1-carboxylic acid |
| SMILES | C[C@H]1CC(C(=O)O)CC[C@H]1C(=O)N1CC[C@H]2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]21 |
| InChI | InChI=1S/C24H26F7NO3/c1-12-10-14(21(34)35)2-5-16(12)20(33)32-9-8-18-17-6-4-15(11-13(17)3-7-19(18)32)22(25,23(26,27)28)24(29,30)31/h4,6,11-12,14,16,18-19H,2-3,5,7-10H2,1H3,(H,34,35)/t12-,14?,16+,18-,19+/m0/s1 |
| InChIKey | WZSTTXDRHKGLJZ-GDDGTDKCSA-N |
| XLogP | 5.74 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |