C24H26F7NO3 — CID 134510968
4-[[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]carbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 134510968) has the molecular formula C24H26F7NO3 and a molecular weight of 509.46 g/mol. Its IUPAC name is 4-[[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]carbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]carbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 134510968 |
| Molecular Formula | C24H26F7NO3 |
| Molecular Weight | 509.46 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 4-[[(3R,3aR,9bR)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalen-3-yl]carbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)N[C@@H]2CC[C@H]3c4ccc(C(F)(C(F)(F)F)C(F)(F)F)cc4CC[C@@H]23)CC1 |
| InChI | InChI=1S/C24H26F7NO3/c25-22(23(26,27)28,24(29,30)31)15-6-8-16-14(11-15)5-7-18-17(16)9-10-19(18)32-20(33)12-1-3-13(4-2-12)21(34)35/h6,8,11-13,17-19H,1-5,7,9-10H2,(H,32,33)(H,34,35)/t12?,13?,17-,18+,19+/m0/s1 |
| InChIKey | JNVXVEGAMYXZFK-YFMFIUCISA-N |
| XLogP | 5.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.46 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |