C22H22F7NO — CID 155031868
(3R)-N-(1-bicyclo[1.1.1]pentanyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide (PubChem CID 155031868) has the molecular formula C22H22F7NO and a molecular weight of 449.41 g/mol. Its IUPAC name is (3R)-N-(1-bicyclo[1.1.1]pentanyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide.
| Compound Name | (3R)-N-(1-bicyclo[1.1.1]pentanyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
|---|---|
| PubChem CID | 155031868 |
| Molecular Formula | C22H22F7NO |
| Molecular Weight | 449.41 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (3R)-N-(1-bicyclo[1.1.1]pentanyl)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,3,3a,4,5,9b-hexahydro-1H-cyclopenta[a]naphthalene-3-carboxamide |
| SMILES | O=C(NC12CC(C1)C2)[C@@H]1CCC2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CCC21 |
| InChI | InChI=1S/C22H22F7NO/c23-20(21(24,25)26,22(27,28)29)13-2-4-14-12(7-13)1-3-16-15(14)5-6-17(16)18(31)30-19-8-11(9-19)10-19/h2,4,7,11,15-17H,1,3,5-6,8-10H2,(H,30,31)/t11?,15?,16?,17-,19?/m1/s1 |
| InChIKey | SLARTXWMRFFWPN-IHKICUNLSA-N |
| XLogP | 5.70 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.41 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |