C20H20F7NO2 — CID 145184308
[(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclobutyl)methanone (PubChem CID 145184308) has the molecular formula C20H20F7NO2 and a molecular weight of 439.37 g/mol. Its IUPAC name is [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclobutyl)methanone.
| Compound Name | [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclobutyl)methanone |
|---|---|
| PubChem CID | 145184308 |
| Molecular Formula | C20H20F7NO2 |
| Molecular Weight | 439.37 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | [(3aR,9bS)-7-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-1,2,3a,4,5,9b-hexahydrobenzo[e]indol-3-yl]-(1-hydroxycyclobutyl)methanone |
| SMILES | O=C(N1CC[C@H]2c3ccc(C(F)(C(F)(F)F)C(F)(F)F)cc3CC[C@H]21)C1(O)CCC1 |
| InChI | InChI=1S/C20H20F7NO2/c21-18(19(22,23)24,20(25,26)27)12-3-4-13-11(10-12)2-5-15-14(13)6-9-28(15)16(29)17(30)7-1-8-17/h3-4,10,14-15,30H,1-2,5-9H2/t14-,15+/m0/s1 |
| InChIKey | JQMFEYVKWSEDOR-LSDHHAIUSA-N |
| XLogP | 4.52 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |