(1,1-dihydroxythiolan-3-yl)carbamic acid

C5H11NO4S — CID 134521879

IUPAC(1,1-dihydroxythiolan-3-yl)carbamic acid
SMILESO=C(O)NC1CCS(O)(O)C1
InChIInChI=1S/C5H11NO4S/c7-5(8)6-4-1-2-11(9,10)3-4/h4,6,9-10H,1-3H2,(H,7,8)
InChIKeyURIGDJWMJLTEPL-UHFFFAOYSA-N
MW181.21 g/mol
LogP0.78
Rot. Bonds1

About (1,1-dihydroxythiolan-3-yl)carbamic acid

(1,1-dihydroxythiolan-3-yl)carbamic acid (PubChem CID 134521879) has the molecular formula C5H11NO4S and a molecular weight of 181.21 g/mol. Its IUPAC name is (1,1-dihydroxythiolan-3-yl)carbamic acid.

Molecular Properties

Compound Name(1,1-dihydroxythiolan-3-yl)carbamic acid
PubChem CID134521879
Molecular FormulaC5H11NO4S
Molecular Weight181.21 g/mol
Exact Mass181.04
IUPAC Name(1,1-dihydroxythiolan-3-yl)carbamic acid
SMILESO=C(O)NC1CCS(O)(O)C1
InChIInChI=1S/C5H11NO4S/c7-5(8)6-4-1-2-11(9,10)3-4/h4,6,9-10H,1-3H2,(H,7,8)
InChIKeyURIGDJWMJLTEPL-UHFFFAOYSA-N
XLogP0.78
TPSA89.79 Ų
H-Bond Donors4
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.21
LogP ≤ 50.78
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 103

Analyze (1,1-dihydroxythiolan-3-yl)carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (1,1-dihydroxythiolan-3-yl)carbamic acid?
The IUPAC name of (1,1-dihydroxythiolan-3-yl)carbamic acid (CID 134521879) is (1,1-dihydroxythiolan-3-yl)carbamic acid.
What is the SMILES notation for (1,1-dihydroxythiolan-3-yl)carbamic acid?
The canonical SMILES for (1,1-dihydroxythiolan-3-yl)carbamic acid is O=C(O)NC1CCS(O)(O)C1.
What is the InChIKey of (1,1-dihydroxythiolan-3-yl)carbamic acid?
The InChIKey is URIGDJWMJLTEPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO4S/c7-5(8)6-4-1-2-11(9,10)3-4/h4,6,9-10H,1-3H2,(H,7,8).
What are the key properties of (1,1-dihydroxythiolan-3-yl)carbamic acid?
(1,1-dihydroxythiolan-3-yl)carbamic acid has a molecular weight of 181.21 g/mol, XLogP of 0.78, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,1-dihydroxythiolan-3-yl)carbamic acid is sourced from PubChem (CID 134521879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).