C14H13N3 — CID 134550866
4-cyclohexa-1,5-dien-1-yl-3-phenyl-1,2,4-triazole (PubChem CID 134550866) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 4-cyclohexa-1,5-dien-1-yl-3-phenyl-1,2,4-triazole.
| Compound Name | 4-cyclohexa-1,5-dien-1-yl-3-phenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 134550866 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 4-cyclohexa-1,5-dien-1-yl-3-phenyl-1,2,4-triazole |
| SMILES | C1=CC(n2cnnc2-c2ccccc2)=CCC1 |
| InChI | InChI=1S/C14H13N3/c1-3-7-12(8-4-1)14-16-15-11-17(14)13-9-5-2-6-10-13/h1,3-5,7-11H,2,6H2 |
| InChIKey | IJOZYZKXGUHEEO-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |