C34H29NO3 — CID 134587867
2-amino-2-(hydroxymethyl)propane-1,3-diol;1,3,5-tris(2-phenylethynyl)benzene (PubChem CID 134587867) has the molecular formula C34H29NO3 and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;1,3,5-tris(2-phenylethynyl)benzene.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1,3,5-tris(2-phenylethynyl)benzene |
|---|---|
| PubChem CID | 134587867 |
| Molecular Formula | C34H29NO3 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;1,3,5-tris(2-phenylethynyl)benzene |
| SMILES | C(#Cc1cc(C#Cc2ccccc2)cc(C#Cc2ccccc2)c1)c1ccccc1.NC(CO)(CO)CO |
| InChI | InChI=1S/C30H18.C4H11NO3/c1-4-10-25(11-5-1)16-19-28-22-29(20-17-26-12-6-2-7-13-26)24-30(23-28)21-18-27-14-8-3-9-15-27;5-4(1-6,2-7)3-8/h1-15,22-24H;6-8H,1-3,5H2 |
| InChIKey | OVUVETHXMRVAHX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|